C16H21FS — CID 131992156
2-fluoro-6-[(E)-pent-1-enyl]-3-[(E)-pent-3-enyl]benzenethiol (PubChem CID 131992156) has the molecular formula C16H21FS and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-fluoro-6-[(E)-pent-1-enyl]-3-[(E)-pent-3-enyl]benzenethiol.
| Compound Name | 2-fluoro-6-[(E)-pent-1-enyl]-3-[(E)-pent-3-enyl]benzenethiol |
|---|---|
| PubChem CID | 131992156 |
| Molecular Formula | C16H21FS |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-fluoro-6-[(E)-pent-1-enyl]-3-[(E)-pent-3-enyl]benzenethiol |
| SMILES | C/C=C/CCc1ccc(/C=C/CCC)c(S)c1F |
| InChI | InChI=1S/C16H21FS/c1-3-5-7-9-13-11-12-14(10-8-6-4-2)16(18)15(13)17/h3,5,8,10-12,18H,4,6-7,9H2,1-2H3/b5-3+,10-8+ |
| InChIKey | WHBJLAGRBRZLSC-KWRXBJJZSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|