C37H38F6O — CID 88893963
2-[4-[4-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]cyclohexyl]-2,3-difluorophenyl]oxirane (PubChem CID 88893963) has the molecular formula C37H38F6O and a molecular weight of 612.70 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]cyclohexyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]cyclohexyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88893963 |
| Molecular Formula | C37H38F6O |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | 2-[4-[4-[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]cyclohexyl]-2,3-difluorophenyl]oxirane |
| SMILES | C/C=C/CCc1ccc(C2CCC(c3ccc(C4CCC(c5ccc(C6CO6)c(F)c5F)CC4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C37H38F6O/c1-2-3-4-5-25-14-15-26(33(39)32(25)38)21-6-8-22(9-7-21)27-16-17-28(35(41)34(27)40)23-10-12-24(13-11-23)29-18-19-30(31-20-44-31)37(43)36(29)42/h2-3,14-19,21-24,31H,4-13,20H2,1H3/b3-2+ |
| InChIKey | QTYMWSDCJBQBTN-NSCUHMNNSA-N |
| XLogP | 10.98 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|