C28H32F2O — CID 88861062
2-[4-[(E)-4-[4-(4-but-3-enylcyclohexyl)phenyl]but-3-enyl]-2,3-difluorophenyl]oxirane (PubChem CID 88861062) has the molecular formula C28H32F2O and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-[4-[(E)-4-[4-(4-but-3-enylcyclohexyl)phenyl]but-3-enyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[(E)-4-[4-(4-but-3-enylcyclohexyl)phenyl]but-3-enyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88861062 |
| Molecular Formula | C28H32F2O |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[4-[(E)-4-[4-(4-but-3-enylcyclohexyl)phenyl]but-3-enyl]-2,3-difluorophenyl]oxirane |
| SMILES | C=CCCC1CCC(c2ccc(/C=C/CCc3ccc(C4CO4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C28H32F2O/c1-2-3-6-20-9-13-22(14-10-20)23-15-11-21(12-16-23)7-4-5-8-24-17-18-25(26-19-31-26)28(30)27(24)29/h2,4,7,11-12,15-18,20,22,26H,1,3,5-6,8-10,13-14,19H2/b7-4+ |
| InChIKey | PKGDVWKABJBIBK-QPJJXVBHSA-N |
| XLogP | 7.92 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|