C32H34F4 — CID 139870278
2-[4-[2-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]-2,3-difluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870278) has the molecular formula C32H34F4 and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-[4-[2-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]-2,3-difluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]-2,3-difluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870278 |
| Molecular Formula | C32H34F4 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 2-[4-[2-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]ethynyl]-2,3-difluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCc1ccc(C#Cc2ccc(C3CCC4CC(/C=C/C)CCC4C3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H34F4/c1-3-5-6-8-22-11-12-23(30(34)29(22)33)13-14-24-17-18-28(32(36)31(24)35)27-16-15-25-19-21(7-4-2)9-10-26(25)20-27/h3-5,7,11-12,17-18,21,25-27H,6,8-10,15-16,19-20H2,1-2H3/b5-3+,7-4+ |
| InChIKey | LSHIKEUVJFPDTR-HJIKTHEYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|