C37H42F4 — CID 67738341
1-butyl-4-[4-[2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene (PubChem CID 67738341) has the molecular formula C37H42F4 and a molecular weight of 562.74 g/mol. Its IUPAC name is 1-butyl-4-[4-[2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-butyl-4-[4-[2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67738341 |
| Molecular Formula | C37H42F4 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 1-butyl-4-[4-[2,3-difluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene |
| SMILES | C/C=C/C1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(CCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C37H42F4/c1-3-5-7-30-20-21-31(35(39)34(30)38)28-16-18-29(19-17-28)33-23-22-32(36(40)37(33)41)27-14-12-26(13-15-27)25-10-8-24(6-4-2)9-11-25/h4,6,16-27H,3,5,7-15H2,1-2H3/b6-4+ |
| InChIKey | GMRWNZDOWPKTDM-GQCTYLIASA-N |
| XLogP | 11.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|