C27H34F2 — CID 20807780
2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-[(E)-pent-3-enyl]naphthalene (PubChem CID 20807780) has the molecular formula C27H34F2 and a molecular weight of 396.57 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 20807780 |
| Molecular Formula | C27H34F2 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1cc(F)c2c(F)c([C@@H]3CC[C@@H]4CC(CC)CCC4C3)ccc2c1 |
| InChI | InChI=1S/C27H34F2/c1-3-5-6-7-19-15-23-12-13-24(27(29)26(23)25(28)16-19)22-11-10-20-14-18(4-2)8-9-21(20)17-22/h3,5,12-13,15-16,18,20-22H,4,6-11,14,17H2,1-2H3/b5-3+/t18?,20-,21?,22-/m1/s1 |
| InChIKey | UFDDNGVWSPBGQZ-AXEIIISCSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|