C26H32F2 — CID 20807649
7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6-difluoro-3-[(E)-pent-3-enyl]naphthalene (PubChem CID 20807649) has the molecular formula C26H32F2 and a molecular weight of 382.54 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6-difluoro-3-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6-difluoro-3-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 20807649 |
| Molecular Formula | C26H32F2 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 7-[(2R,4aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,6-difluoro-3-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1cc(F)c2cc([C@@H]3CC[C@@H]4CC(C)CCC4C3)c(F)cc2c1 |
| InChI | InChI=1S/C26H32F2/c1-3-4-5-6-18-12-22-15-26(28)23(16-24(22)25(27)13-18)21-10-9-19-11-17(2)7-8-20(19)14-21/h3-4,12-13,15-17,19-21H,5-11,14H2,1-2H3/b4-3+/t17?,19-,20?,21-/m1/s1 |
| InChIKey | VPTKGELVPZKSNW-AVSMYEKZSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|