C28H36 — CID 20809526
(4aR,6R,8aR)-2-methyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809526) has the molecular formula C28H36 and a molecular weight of 372.60 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-methyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-methyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809526 |
| Molecular Formula | C28H36 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (4aR,6R,8aR)-2-methyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc([C@@H]3CC[C@@H]4CC(C)CC[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C28H36/c1-3-4-5-6-22-8-11-23(12-9-22)24-13-15-25(16-14-24)27-18-17-26-19-21(2)7-10-28(26)20-27/h3-4,8-9,11-16,21,26-28H,5-7,10,17-20H2,1-2H3/b4-3+/t21?,26-,27-,28-/m1/s1 |
| InChIKey | VUEQGJZZRPMSHM-LAVRQKEESA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|