C29H38 — CID 20809523
(4aR,6R,8aR)-2-ethyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809523) has the molecular formula C29H38 and a molecular weight of 386.62 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-ethyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-ethyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809523 |
| Molecular Formula | C29H38 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (4aR,6R,8aR)-2-ethyl-6-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc([C@@H]3CC[C@@H]4CC(CC)CC[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C29H38/c1-3-5-6-7-23-9-11-24(12-10-23)25-14-16-26(17-15-25)28-19-18-27-20-22(4-2)8-13-29(27)21-28/h3,5,9-12,14-17,22,27-29H,4,6-8,13,18-21H2,1-2H3/b5-3+/t22?,27-,28-,29-/m1/s1 |
| InChIKey | RBZLFYZPTFIRJE-DEZVKHSTSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|