C27H36 — CID 20807949
2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-pent-3-enyl]naphthalene (PubChem CID 20807949) has the molecular formula C27H36 and a molecular weight of 360.59 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 20807949 |
| Molecular Formula | C27H36 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 2-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2cc([C@@H]3CC[C@@H]4CC(CC)CCC4C3)ccc2c1 |
| InChI | InChI=1S/C27H36/c1-3-5-6-7-21-9-11-25-19-27(15-13-23(25)17-21)26-14-12-22-16-20(4-2)8-10-24(22)18-26/h3,5,9,11,13,15,17,19-20,22,24,26H,4,6-8,10,12,14,16,18H2,1-2H3/b5-3+/t20?,22-,24?,26-/m1/s1 |
| InChIKey | IBTIAIKKWAOSJN-RQEWQVRYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|