C29H37FO — CID 139869719
2-ethoxy-6-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869719) has the molecular formula C29H37FO and a molecular weight of 420.61 g/mol. Its IUPAC name is 2-ethoxy-6-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-ethoxy-6-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869719 |
| Molecular Formula | C29H37FO |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 2-ethoxy-6-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C3CCC4CC(OCC)CCC4C3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H37FO/c1-3-5-6-7-21-8-10-22(11-9-21)25-15-17-28(29(30)20-25)26-13-12-24-19-27(31-4-2)16-14-23(24)18-26/h3,5,8-11,15,17,20,23-24,26-27H,4,6-7,12-14,16,18-19H2,1-2H3/b5-3+ |
| InChIKey | SECBMDYGIFHQQF-HWKANZROSA-N |
| XLogP | 8.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|