C24H28F2O — CID 139749265
4-but-3-enyl-1-[4-(4-ethoxycyclohexyl)-3-fluorophenyl]-2-fluorobenzene (PubChem CID 139749265) has the molecular formula C24H28F2O and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-but-3-enyl-1-[4-(4-ethoxycyclohexyl)-3-fluorophenyl]-2-fluorobenzene.
| Compound Name | 4-but-3-enyl-1-[4-(4-ethoxycyclohexyl)-3-fluorophenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 139749265 |
| Molecular Formula | C24H28F2O |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 4-but-3-enyl-1-[4-(4-ethoxycyclohexyl)-3-fluorophenyl]-2-fluorobenzene |
| SMILES | C=CCCc1ccc(-c2ccc(C3CCC(OCC)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C24H28F2O/c1-3-5-6-17-7-13-22(23(25)15-17)19-10-14-21(24(26)16-19)18-8-11-20(12-9-18)27-4-2/h3,7,10,13-16,18,20H,1,4-6,8-9,11-12H2,2H3 |
| InChIKey | UJFLHPSMOZWTBS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|