C17H23F — CID 71422815
1-(4-ethenylcyclohexyl)-2-fluoro-4-propylbenzene (PubChem CID 71422815) has the molecular formula C17H23F and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-2-fluoro-4-propylbenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-2-fluoro-4-propylbenzene |
|---|---|
| PubChem CID | 71422815 |
| Molecular Formula | C17H23F |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-2-fluoro-4-propylbenzene |
| SMILES | C=CC1CCC(c2ccc(CCC)cc2F)CC1 |
| InChI | InChI=1S/C17H23F/c1-3-5-14-8-11-16(17(18)12-14)15-9-6-13(4-2)7-10-15/h4,8,11-13,15H,2-3,5-7,9-10H2,1H3 |
| InChIKey | ODAMVSRNOWVZRB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|