C14H19FO — CID 153081672
4-(2-fluoro-4-propylphenyl)oxane (PubChem CID 153081672) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is 4-(2-fluoro-4-propylphenyl)oxane.
| Compound Name | 4-(2-fluoro-4-propylphenyl)oxane |
|---|---|
| PubChem CID | 153081672 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-(2-fluoro-4-propylphenyl)oxane |
| SMILES | CCCc1ccc(C2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C14H19FO/c1-2-3-11-4-5-13(14(15)10-11)12-6-8-16-9-7-12/h4-5,10,12H,2-3,6-9H2,1H3 |
| InChIKey | VNJVLKMFZGSMPN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |