C25H31FO — CID 139749386
4-but-3-enyl-2-fluoro-1-[4-(4-propoxycyclohexyl)phenyl]benzene (PubChem CID 139749386) has the molecular formula C25H31FO and a molecular weight of 366.52 g/mol. Its IUPAC name is 4-but-3-enyl-2-fluoro-1-[4-(4-propoxycyclohexyl)phenyl]benzene.
| Compound Name | 4-but-3-enyl-2-fluoro-1-[4-(4-propoxycyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 139749386 |
| Molecular Formula | C25H31FO |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-but-3-enyl-2-fluoro-1-[4-(4-propoxycyclohexyl)phenyl]benzene |
| SMILES | C=CCCc1ccc(-c2ccc(C3CCC(OCCC)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C25H31FO/c1-3-5-6-19-7-16-24(25(26)18-19)22-10-8-20(9-11-22)21-12-14-23(15-13-21)27-17-4-2/h3,7-11,16,18,21,23H,1,4-6,12-15,17H2,2H3 |
| InChIKey | DIDDEBOMXJRDSI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|