C28H37FO — CID 139749316
2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]-1-(4-pentoxycyclohexyl)benzene (PubChem CID 139749316) has the molecular formula C28H37FO and a molecular weight of 408.60 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]-1-(4-pentoxycyclohexyl)benzene.
| Compound Name | 2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]-1-(4-pentoxycyclohexyl)benzene |
|---|---|
| PubChem CID | 139749316 |
| Molecular Formula | C28H37FO |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]-1-(4-pentoxycyclohexyl)benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C3CCC(OCCCCC)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H37FO/c1-3-5-7-9-22-10-12-23(13-11-22)25-16-19-27(28(29)21-25)24-14-17-26(18-15-24)30-20-8-6-4-2/h3,5,10-13,16,19,21,24,26H,4,6-9,14-15,17-18,20H2,1-2H3/b5-3+ |
| InChIKey | PEAFIDKVBHHMSS-HWKANZROSA-N |
| XLogP | 8.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|