C24H28F2O — CID 139749423
2,3-difluoro-1-(4-methoxycyclohexyl)-4-[4-[(E)-pent-3-enyl]phenyl]benzene (PubChem CID 139749423) has the molecular formula C24H28F2O and a molecular weight of 370.48 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-methoxycyclohexyl)-4-[4-[(E)-pent-3-enyl]phenyl]benzene.
| Compound Name | 2,3-difluoro-1-(4-methoxycyclohexyl)-4-[4-[(E)-pent-3-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 139749423 |
| Molecular Formula | C24H28F2O |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2,3-difluoro-1-(4-methoxycyclohexyl)-4-[4-[(E)-pent-3-enyl]phenyl]benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C3CCC(OC)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H28F2O/c1-3-4-5-6-17-7-9-18(10-8-17)21-15-16-22(24(26)23(21)25)19-11-13-20(27-2)14-12-19/h3-4,7-10,15-16,19-20H,5-6,11-14H2,1-2H3/b4-3+ |
| InChIKey | QCRVZAZZGVGFBZ-ONEGZZNKSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|