C25H29F3O — CID 20807455
7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-prop-2-enoxynaphthalene (PubChem CID 20807455) has the molecular formula C25H29F3O and a molecular weight of 402.50 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-prop-2-enoxynaphthalene.
| Compound Name | 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 20807455 |
| Molecular Formula | C25H29F3O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1cc2ccc([C@@H]3CC[C@@H]4CC(CC)CCC4C3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C25H29F3O/c1-3-11-29-21-14-19-9-10-20(23(26)22(19)25(28)24(21)27)18-8-7-16-12-15(4-2)5-6-17(16)13-18/h3,9-10,14-18H,1,4-8,11-13H2,2H3/t15?,16-,17?,18-/m1/s1 |
| InChIKey | FJDLKOHGGCMJHX-GPQLOAJWSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|