C27H34F2O — CID 70229900
2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-prop-2-enoxynaphthalene (PubChem CID 70229900) has the molecular formula C27H34F2O and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-prop-2-enoxynaphthalene.
| Compound Name | 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 70229900 |
| Molecular Formula | C27H34F2O |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoro-6-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1cc(F)c2c(F)c([C@@H]3CC[C@@H]4CC(CCCC)CCC4C3)ccc2c1 |
| InChI | InChI=1S/C27H34F2O/c1-3-5-6-18-7-8-20-15-21(10-9-19(20)14-18)24-12-11-22-16-23(30-13-4-2)17-25(28)26(22)27(24)29/h4,11-12,16-21H,2-3,5-10,13-15H2,1H3/t18?,19-,20?,21-/m1/s1 |
| InChIKey | JUEUODDGAVYMKV-GOLJUSPKSA-N |
| XLogP | 8.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|