C28H35F3O — CID 20807573
2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-but-2-enoxy]-1,3,8-trifluoronaphthalene (PubChem CID 20807573) has the molecular formula C28H35F3O and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-but-2-enoxy]-1,3,8-trifluoronaphthalene.
| Compound Name | 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-but-2-enoxy]-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 20807573 |
| Molecular Formula | C28H35F3O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-[(E)-but-2-enoxy]-1,3,8-trifluoronaphthalene |
| SMILES | C/C=C/COc1cc(F)c2c(F)c([C@@H]3CC[C@@H]4CC(CCCC)CCC4C3)c(F)cc2c1 |
| InChI | InChI=1S/C28H35F3O/c1-3-5-7-18-8-9-20-14-21(11-10-19(20)13-18)26-24(29)16-22-15-23(32-12-6-4-2)17-25(30)27(22)28(26)31/h4,6,15-21H,3,5,7-14H2,1-2H3/b6-4+/t18?,19-,20?,21-/m1/s1 |
| InChIKey | IJBJBLFQITWZAJ-CBZCESGZSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|