C26H31F3O — CID 20807475
6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2,8-trifluoronaphthalene (PubChem CID 20807475) has the molecular formula C26H31F3O and a molecular weight of 416.53 g/mol. Its IUPAC name is 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2,8-trifluoronaphthalene.
| Compound Name | 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 20807475 |
| Molecular Formula | C26H31F3O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 6-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2,8-trifluoronaphthalene |
| SMILES | C/C=C/COc1cc2cc([C@@H]3CC[C@@H]4CC(CC)CCC4C3)cc(F)c2c(F)c1F |
| InChI | InChI=1S/C26H31F3O/c1-3-5-10-30-23-15-21-13-20(14-22(27)24(21)26(29)25(23)28)19-9-8-17-11-16(4-2)6-7-18(17)12-19/h3,5,13-19H,4,6-12H2,1-2H3/b5-3+/t16?,17-,18?,19-/m1/s1 |
| InChIKey | VTRXEIVUJDIUEW-RGSSRPGXSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|