C30H39F3 — CID 20807562
2-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enyl-1,3,8-trifluoronaphthalene (PubChem CID 20807562) has the molecular formula C30H39F3 and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enyl-1,3,8-trifluoronaphthalene.
| Compound Name | 2-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enyl-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 20807562 |
| Molecular Formula | C30H39F3 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 2-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-but-3-enyl-1,3,8-trifluoronaphthalene |
| SMILES | C=CCCc1cc(F)c2c(F)c([C@@H]3CC[C@@H]4CC(CCCCCC)CCC4C3)c(F)cc2c1 |
| InChI | InChI=1S/C30H39F3/c1-3-5-7-8-10-20-11-12-23-18-24(14-13-22(23)15-20)28-27(32)19-25-16-21(9-6-4-2)17-26(31)29(25)30(28)33/h4,16-17,19-20,22-24H,2-3,5-15,18H2,1H3/t20?,22-,23?,24-/m1/s1 |
| InChIKey | SGRKYCAURQKIBV-RSHDMXJRSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|