C26H32ClF3 — CID 20808196
3-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-chloro-1,6,8-trifluoronaphthalene (PubChem CID 20808196) has the molecular formula C26H32ClF3 and a molecular weight of 436.99 g/mol. Its IUPAC name is 3-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-chloro-1,6,8-trifluoronaphthalene.
| Compound Name | 3-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-chloro-1,6,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 20808196 |
| Molecular Formula | C26H32ClF3 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-chloro-1,6,8-trifluoronaphthalene |
| SMILES | CCCCCC[C@@H]1CC[C@@H]2CC(c3cc4cc(F)cc(F)c4c(F)c3Cl)CCC2C1 |
| InChI | InChI=1S/C26H32ClF3/c1-2-3-4-5-6-16-7-8-18-12-19(10-9-17(18)11-16)22-14-20-13-21(28)15-23(29)24(20)26(30)25(22)27/h13-19H,2-12H2,1H3/t16-,17?,18-,19?/m1/s1 |
| InChIKey | MCHUQNDMWRWSMK-TXQGORRRSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|