C26H31F2N — CID 20808300
3-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoronaphthalene-2-carbonitrile (PubChem CID 20808300) has the molecular formula C26H31F2N and a molecular weight of 395.54 g/mol. Its IUPAC name is 3-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoronaphthalene-2-carbonitrile.
| Compound Name | 3-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 20808300 |
| Molecular Formula | C26H31F2N |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,8-difluoronaphthalene-2-carbonitrile |
| SMILES | CCCCC[C@@H]1CC[C@@H]2CC(c3cc4cccc(F)c4c(F)c3C#N)CCC2C1 |
| InChI | InChI=1S/C26H31F2N/c1-2-3-4-6-17-9-10-19-14-20(12-11-18(19)13-17)22-15-21-7-5-8-24(27)25(21)26(28)23(22)16-29/h5,7-8,15,17-20H,2-4,6,9-14H2,1H3/t17-,18?,19-,20?/m1/s1 |
| InChIKey | FOSXJOKWBQGWPZ-ADEKHHIBSA-N |
| XLogP | 7.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|