C27H35F3O — CID 20807504
3-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-7-methoxynaphthalene (PubChem CID 20807504) has the molecular formula C27H35F3O and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-7-methoxynaphthalene.
| Compound Name | 3-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-7-methoxynaphthalene |
|---|---|
| PubChem CID | 20807504 |
| Molecular Formula | C27H35F3O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 3-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-7-methoxynaphthalene |
| SMILES | CCCCCCC1CCC2C[C@H](c3cc4ccc(OC)c(F)c4c(F)c3F)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H35F3O/c1-3-4-5-6-7-17-8-9-19-15-20(11-10-18(19)14-17)22-16-21-12-13-23(31-2)26(29)24(21)27(30)25(22)28/h12-13,16-20H,3-11,14-15H2,1-2H3/t17?,18-,19?,20-/m1/s1 |
| InChIKey | NRCOFUKWLJRPEW-CQJJOKNBSA-N |
| XLogP | 8.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|