C26H31F3O2 — CID 22383666
methyl 6-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,7,8-trifluoronaphthalene-2-carboxylate (PubChem CID 22383666) has the molecular formula C26H31F3O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is methyl 6-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,7,8-trifluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,7,8-trifluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22383666 |
| Molecular Formula | C26H31F3O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | methyl 6-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,7,8-trifluoronaphthalene-2-carboxylate |
| SMILES | CCCCC1CCC2CC(c3cc4ccc(C(=O)OC)c(F)c4c(F)c3F)CCC2C1 |
| InChI | InChI=1S/C26H31F3O2/c1-3-4-5-15-6-7-17-13-18(9-8-16(17)12-15)21-14-19-10-11-20(26(30)31-2)23(27)22(19)25(29)24(21)28/h10-11,14-18H,3-9,12-13H2,1-2H3 |
| InChIKey | XLLIYNUQUDNFCO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |