C25H30F4 — CID 20808156
6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 20808156) has the molecular formula C25H30F4 and a molecular weight of 406.51 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 20808156 |
| Molecular Formula | C25H30F4 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCC[C@@H]1CC[C@@H]2CC(c3cc(F)c4c(F)c(F)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C25H30F4/c1-2-3-4-5-15-6-7-17-11-18(9-8-16(17)10-15)19-12-20-14-22(27)24(28)25(29)23(20)21(26)13-19/h12-18H,2-11H2,1H3/t15-,16?,17-,18?/m1/s1 |
| InChIKey | BZSCDCBCDNNBIF-RZZCCWGQSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|