C23H27F3O — CID 20807468
7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-methoxynaphthalene (PubChem CID 20807468) has the molecular formula C23H27F3O and a molecular weight of 376.46 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-methoxynaphthalene.
| Compound Name | 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-methoxynaphthalene |
|---|---|
| PubChem CID | 20807468 |
| Molecular Formula | C23H27F3O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 7-[(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,8-trifluoro-3-methoxynaphthalene |
| SMILES | CCC1CCC2C[C@H](c3ccc4cc(OC)c(F)c(F)c4c3F)CC[C@@H]2C1 |
| InChI | InChI=1S/C23H27F3O/c1-3-13-4-5-15-11-16(7-6-14(15)10-13)18-9-8-17-12-19(27-2)22(25)23(26)20(17)21(18)24/h8-9,12-16H,3-7,10-11H2,1-2H3/t13?,14-,15?,16-/m1/s1 |
| InChIKey | SCTGHHUITOJXRT-GYTBAZASSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |