C24H29FO2 — CID 20808811
methyl 6-[(4aS,8aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-5-fluoronaphthalene-2-carboxylate (PubChem CID 20808811) has the molecular formula C24H29FO2 and a molecular weight of 368.49 g/mol. Its IUPAC name is methyl 6-[(4aS,8aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-5-fluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4aS,8aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-5-fluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20808811 |
| Molecular Formula | C24H29FO2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | methyl 6-[(4aS,8aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-5-fluoronaphthalene-2-carboxylate |
| SMILES | CCC1CC[C@@H]2CC(c3ccc4cc(C(=O)OC)ccc4c3F)CC[C@H]2C1 |
| InChI | InChI=1S/C24H29FO2/c1-3-15-4-5-17-13-18(7-6-16(17)12-15)21-10-8-19-14-20(24(26)27-2)9-11-22(19)23(21)25/h8-11,14-18H,3-7,12-13H2,1-2H3/t15?,16-,17+,18?/m0/s1 |
| InChIKey | WKHHSJALQMWNBS-JDEYZFBPSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |