C28H37FO2 — CID 20808817
methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoronaphthalene-2-carboxylate (PubChem CID 20808817) has the molecular formula C28H37FO2 and a molecular weight of 424.60 g/mol. Its IUPAC name is methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20808817 |
| Molecular Formula | C28H37FO2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-8-fluoronaphthalene-2-carboxylate |
| SMILES | CCCCCCC1CC[C@@H]2CC(c3cc(F)c4cc(C(=O)OC)ccc4c3)CC[C@H]2C1 |
| InChI | InChI=1S/C28H37FO2/c1-3-4-5-6-7-19-8-9-21-15-22(11-10-20(21)14-19)25-16-23-12-13-24(28(30)31-2)17-26(23)27(29)18-25/h12-13,16-22H,3-11,14-15H2,1-2H3/t19?,20-,21+,22?/m0/s1 |
| InChIKey | ZLOISXPYPFZTHZ-UTZODRGISA-N |
| XLogP | 8.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|