C12H14O2 — CID 143512870
2-(4-ethenyl-3-ethylphenyl)acetic acid (PubChem CID 143512870) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(4-ethenyl-3-ethylphenyl)acetic acid.
| Compound Name | 2-(4-ethenyl-3-ethylphenyl)acetic acid |
|---|---|
| PubChem CID | 143512870 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(4-ethenyl-3-ethylphenyl)acetic acid |
| SMILES | C=Cc1ccc(CC(=O)O)cc1CC |
| InChI | InChI=1S/C12H14O2/c1-3-10-6-5-9(8-12(13)14)7-11(10)4-2/h3,5-7H,1,4,8H2,2H3,(H,13,14) |
| InChIKey | UDVMEJYKSNHDKE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |