C10H12N2O3 — CID 168531416
2-(4-methanehydrazonoyl-3-methoxyphenyl)acetic acid (PubChem CID 168531416) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(4-methanehydrazonoyl-3-methoxyphenyl)acetic acid.
| Compound Name | 2-(4-methanehydrazonoyl-3-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 168531416 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(4-methanehydrazonoyl-3-methoxyphenyl)acetic acid |
| SMILES | COc1cc(CC(=O)O)ccc1C=NN |
| InChI | InChI=1S/C10H12N2O3/c1-15-9-4-7(5-10(13)14)2-3-8(9)6-12-11/h2-4,6H,5,11H2,1H3,(H,13,14) |
| InChIKey | JBMYSMIPCDRAQA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|