C17H26O — CID 19008550
2,4-dipentylbenzaldehyde (PubChem CID 19008550) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2,4-dipentylbenzaldehyde.
| Compound Name | 2,4-dipentylbenzaldehyde |
|---|---|
| PubChem CID | 19008550 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2,4-dipentylbenzaldehyde |
| SMILES | CCCCCc1ccc(C=O)c(CCCCC)c1 |
| InChI | InChI=1S/C17H26O/c1-3-5-7-9-15-11-12-17(14-18)16(13-15)10-8-6-4-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | IEPIHVGKNLIVJB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|