C16H22O — CID 142240951
4-(2-butoxyethyl)-1,2-bis(ethenyl)benzene (PubChem CID 142240951) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-(2-butoxyethyl)-1,2-bis(ethenyl)benzene.
| Compound Name | 4-(2-butoxyethyl)-1,2-bis(ethenyl)benzene |
|---|---|
| PubChem CID | 142240951 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 4-(2-butoxyethyl)-1,2-bis(ethenyl)benzene |
| SMILES | C=Cc1ccc(CCOCCCC)cc1C=C |
| InChI | InChI=1S/C16H22O/c1-4-7-11-17-12-10-14-8-9-15(5-2)16(6-3)13-14/h5-6,8-9,13H,2-4,7,10-12H2,1H3 |
| InChIKey | GGPYXVPECKDSBE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|