C11H13P — CID 166143558
[3,4-bis(ethenyl)phenyl]methylphosphane (PubChem CID 166143558) has the molecular formula C11H13P and a molecular weight of 176.20 g/mol. Its IUPAC name is [3,4-bis(ethenyl)phenyl]methylphosphane.
| Compound Name | [3,4-bis(ethenyl)phenyl]methylphosphane |
|---|---|
| PubChem CID | 166143558 |
| Molecular Formula | C11H13P |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | [3,4-bis(ethenyl)phenyl]methylphosphane |
| SMILES | C=Cc1ccc(CP)cc1C=C |
| InChI | InChI=1S/C11H13P/c1-3-10-6-5-9(8-12)7-11(10)4-2/h3-7H,1-2,8,12H2 |
| InChIKey | QROKVSDYQTVYQA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|