C12H17N — CID 142131680
3,4-bis(ethenyl)aniline;ethane (PubChem CID 142131680) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 3,4-bis(ethenyl)aniline;ethane.
| Compound Name | 3,4-bis(ethenyl)aniline;ethane |
|---|---|
| PubChem CID | 142131680 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 3,4-bis(ethenyl)aniline;ethane |
| SMILES | C=Cc1ccc(N)cc1C=C.CC |
| InChI | InChI=1S/C10H11N.C2H6/c1-3-8-5-6-10(11)7-9(8)4-2;1-2/h3-7H,1-2,11H2;1-2H3 |
| InChIKey | UFEPVJLHDSDJKU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|