C10H14N2 — CID 154137227
4-ethenyl-1-N,1-N-dimethylbenzene-1,3-diamine (PubChem CID 154137227) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-ethenyl-1-N,1-N-dimethylbenzene-1,3-diamine.
| Compound Name | 4-ethenyl-1-N,1-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 154137227 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-ethenyl-1-N,1-N-dimethylbenzene-1,3-diamine |
| SMILES | C=Cc1ccc(N(C)C)cc1N |
| InChI | InChI=1S/C10H14N2/c1-4-8-5-6-9(12(2)3)7-10(8)11/h4-7H,1,11H2,2-3H3 |
| InChIKey | XFCSMGZFYCWNLN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|