C16H17N3 — CID 102247917
3-ethenyl-N,N-dimethyl-4-phenyldiazenylaniline (PubChem CID 102247917) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-ethenyl-N,N-dimethyl-4-phenyldiazenylaniline.
| Compound Name | 3-ethenyl-N,N-dimethyl-4-phenyldiazenylaniline |
|---|---|
| PubChem CID | 102247917 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-ethenyl-N,N-dimethyl-4-phenyldiazenylaniline |
| SMILES | C=Cc1cc(N(C)C)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H17N3/c1-4-13-12-15(19(2)3)10-11-16(13)18-17-14-8-6-5-7-9-14/h4-12H,1H2,2-3H3/b18-17+ |
| InChIKey | YAMSKMKZHRNMHD-ISLYRVAYSA-N |
| XLogP | 4.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|