About diphenyldiazene;1-ethenyl-2-nitrobenzene
diphenyldiazene;1-ethenyl-2-nitrobenzene (PubChem CID 175087303) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is diphenyldiazene;1-ethenyl-2-nitrobenzene.
Molecular Properties
| Compound Name | diphenyldiazene;1-ethenyl-2-nitrobenzene |
| PubChem CID | 175087303 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | diphenyldiazene;1-ethenyl-2-nitrobenzene |
| SMILES | C=Cc1ccccc1[N+](=O)[O-].c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2.C8H7NO2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2-7-5-3-4-6-8(7)9(10)11/h1-10H;2-6H,1H2/b14-13+; |
| InChIKey | KPERREVDIRAEFG-IERUDJENSA-N |
| XLogP | 6.34 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene;1-ethenyl-2-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene;1-ethenyl-2-nitrobenzene?
The IUPAC name of diphenyldiazene;1-ethenyl-2-nitrobenzene (CID 175087303) is diphenyldiazene;1-ethenyl-2-nitrobenzene.
What is the SMILES notation for diphenyldiazene;1-ethenyl-2-nitrobenzene?
The canonical SMILES for diphenyldiazene;1-ethenyl-2-nitrobenzene is C=Cc1ccccc1[N+](=O)[O-].c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene;1-ethenyl-2-nitrobenzene?
The InChIKey is KPERREVDIRAEFG-IERUDJENSA-N. The full InChI is InChI=1S/C12H10N2.C8H7NO2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2-7-5-3-4-6-8(7)9(10)11/h1-10H;2-6H,1H2/b14-13+;.
What are the key properties of diphenyldiazene;1-ethenyl-2-nitrobenzene?
diphenyldiazene;1-ethenyl-2-nitrobenzene has a molecular weight of 331.38 g/mol, XLogP of 6.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene;1-ethenyl-2-nitrobenzene is sourced from PubChem (CID 175087303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).