About 1-ethenyl-2-nitrobenzene;phenol
1-ethenyl-2-nitrobenzene;phenol (PubChem CID 174937072) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is 1-ethenyl-2-nitrobenzene;phenol.
Molecular Properties
| Compound Name | 1-ethenyl-2-nitrobenzene;phenol |
| PubChem CID | 174937072 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-ethenyl-2-nitrobenzene;phenol |
| SMILES | C=Cc1ccccc1[N+](=O)[O-].Oc1ccccc1 |
| InChI | InChI=1S/C8H7NO2.C6H6O/c1-2-7-5-3-4-6-8(7)9(10)11;7-6-4-2-1-3-5-6/h2-6H,1H2;1-5,7H |
| InChIKey | TYBKUSBRHWQAMJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-nitrobenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-nitrobenzene;phenol?
The IUPAC name of 1-ethenyl-2-nitrobenzene;phenol (CID 174937072) is 1-ethenyl-2-nitrobenzene;phenol.
What is the SMILES notation for 1-ethenyl-2-nitrobenzene;phenol?
The canonical SMILES for 1-ethenyl-2-nitrobenzene;phenol is C=Cc1ccccc1[N+](=O)[O-].Oc1ccccc1.
What is the InChIKey of 1-ethenyl-2-nitrobenzene;phenol?
The InChIKey is TYBKUSBRHWQAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2.C6H6O/c1-2-7-5-3-4-6-8(7)9(10)11;7-6-4-2-1-3-5-6/h2-6H,1H2;1-5,7H.
What are the key properties of 1-ethenyl-2-nitrobenzene;phenol?
1-ethenyl-2-nitrobenzene;phenol has a molecular weight of 243.26 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-nitrobenzene;phenol is sourced from PubChem (CID 174937072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).