About 3-ethenyl-4-nitrophenol
3-ethenyl-4-nitrophenol (PubChem CID 18352402) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-ethenyl-4-nitrophenol.
Molecular Properties
| Compound Name | 3-ethenyl-4-nitrophenol |
| PubChem CID | 18352402 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 3-ethenyl-4-nitrophenol |
| SMILES | C=Cc1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO3/c1-2-6-5-7(10)3-4-8(6)9(11)12/h2-5,10H,1H2 |
| InChIKey | YDNNZQUXAXERGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4-nitrophenol?
The IUPAC name of 3-ethenyl-4-nitrophenol (CID 18352402) is 3-ethenyl-4-nitrophenol.
What is the SMILES notation for 3-ethenyl-4-nitrophenol?
The canonical SMILES for 3-ethenyl-4-nitrophenol is C=Cc1cc(O)ccc1[N+](=O)[O-].
What is the InChIKey of 3-ethenyl-4-nitrophenol?
The InChIKey is YDNNZQUXAXERGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c1-2-6-5-7(10)3-4-8(6)9(11)12/h2-5,10H,1H2.
What are the key properties of 3-ethenyl-4-nitrophenol?
3-ethenyl-4-nitrophenol has a molecular weight of 165.15 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4-nitrophenol is sourced from PubChem (CID 18352402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).