About 3-amino-4-nitrophenol;ethane
3-amino-4-nitrophenol;ethane (PubChem CID 142035460) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-amino-4-nitrophenol;ethane.
Molecular Properties
| Compound Name | 3-amino-4-nitrophenol;ethane |
| PubChem CID | 142035460 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-amino-4-nitrophenol;ethane |
| SMILES | CC.Nc1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N2O3.C2H6/c7-5-3-4(9)1-2-6(5)8(10)11;1-2/h1-3,9H,7H2;1-2H3 |
| InChIKey | KXJOGIOUODRHIL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-nitrophenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-nitrophenol;ethane?
The IUPAC name of 3-amino-4-nitrophenol;ethane (CID 142035460) is 3-amino-4-nitrophenol;ethane.
What is the SMILES notation for 3-amino-4-nitrophenol;ethane?
The canonical SMILES for 3-amino-4-nitrophenol;ethane is CC.Nc1cc(O)ccc1[N+](=O)[O-].
What is the InChIKey of 3-amino-4-nitrophenol;ethane?
The InChIKey is KXJOGIOUODRHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3.C2H6/c7-5-3-4(9)1-2-6(5)8(10)11;1-2/h1-3,9H,7H2;1-2H3.
What are the key properties of 3-amino-4-nitrophenol;ethane?
3-amino-4-nitrophenol;ethane has a molecular weight of 184.19 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-nitrophenol;ethane is sourced from PubChem (CID 142035460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).