C12H19N3O5 — CID 71360717
N,N-diethylethanamine;3,4-dinitrophenol (PubChem CID 71360717) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is N,N-diethylethanamine;3,4-dinitrophenol.
| Compound Name | N,N-diethylethanamine;3,4-dinitrophenol |
|---|---|
| PubChem CID | 71360717 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N,N-diethylethanamine;3,4-dinitrophenol |
| SMILES | CCN(CC)CC.O=[N+]([O-])c1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N2O5.C6H15N/c9-4-1-2-5(7(10)11)6(3-4)8(12)13;1-4-7(5-2)6-3/h1-3,9H;4-6H2,1-3H3 |
| InChIKey | VOMMIMQNPAFYEB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|