About 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol
4-amino-3-ethylphenol;3-ethyl-4-nitrophenol (PubChem CID 159911548) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol.
Molecular Properties
| Compound Name | 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol |
| PubChem CID | 159911548 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol |
| SMILES | CCc1cc(O)ccc1N.CCc1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9NO3.C8H11NO/c1-2-6-5-7(10)3-4-8(6)9(11)12;1-2-6-5-7(10)3-4-8(6)9/h3-5,10H,2H2,1H3;3-5,10H,2,9H2,1H3 |
| InChIKey | NXFXQURZMVDJCE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol?
The IUPAC name of 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol (CID 159911548) is 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol.
What is the SMILES notation for 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol?
The canonical SMILES for 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol is CCc1cc(O)ccc1N.CCc1cc(O)ccc1[N+](=O)[O-].
What is the InChIKey of 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol?
The InChIKey is NXFXQURZMVDJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.C8H11NO/c1-2-6-5-7(10)3-4-8(6)9(11)12;1-2-6-5-7(10)3-4-8(6)9/h3-5,10H,2H2,1H3;3-5,10H,2,9H2,1H3.
What are the key properties of 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol?
4-amino-3-ethylphenol;3-ethyl-4-nitrophenol has a molecular weight of 304.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethylphenol;3-ethyl-4-nitrophenol is sourced from PubChem (CID 159911548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).