C10H8N2O7 — CID 154809804
4-amino-3-nitrophenol;3,4-dihydroxycyclobut-3-ene-1,2-dione (PubChem CID 154809804) has the molecular formula C10H8N2O7 and a molecular weight of 268.18 g/mol. Its IUPAC name is 4-amino-3-nitrophenol;3,4-dihydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 4-amino-3-nitrophenol;3,4-dihydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 154809804 |
| Molecular Formula | C10H8N2O7 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-amino-3-nitrophenol;3,4-dihydroxycyclobut-3-ene-1,2-dione |
| SMILES | Nc1ccc(O)cc1[N+](=O)[O-].O=c1c(O)c(O)c1=O |
| InChI | InChI=1S/C6H6N2O3.C4H2O4/c7-5-2-1-4(9)3-6(5)8(10)11;5-1-2(6)4(8)3(1)7/h1-3,9H,7H2;5-6H |
| InChIKey | BQFYNKMMRRJSCL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|