About 5-bromo-2-nitroaniline;methane
5-bromo-2-nitroaniline;methane (PubChem CID 139511978) has the molecular formula C7H9BrN2O2
and a molecular weight of 233.06 g/mol. Its IUPAC name is 5-bromo-2-nitroaniline;methane.
Molecular Properties
| Compound Name | 5-bromo-2-nitroaniline;methane |
| PubChem CID | 139511978 |
| Molecular Formula | C7H9BrN2O2 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 5-bromo-2-nitroaniline;methane |
| SMILES | C.Nc1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5BrN2O2.CH4/c7-4-1-2-6(9(10)11)5(8)3-4;/h1-3H,8H2;1H4 |
| InChIKey | YTPUFYSOARQNJC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-nitroaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-nitroaniline;methane?
The IUPAC name of 5-bromo-2-nitroaniline;methane (CID 139511978) is 5-bromo-2-nitroaniline;methane.
What is the SMILES notation for 5-bromo-2-nitroaniline;methane?
The canonical SMILES for 5-bromo-2-nitroaniline;methane is C.Nc1cc(Br)ccc1[N+](=O)[O-].
What is the InChIKey of 5-bromo-2-nitroaniline;methane?
The InChIKey is YTPUFYSOARQNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN2O2.CH4/c7-4-1-2-6(9(10)11)5(8)3-4;/h1-3H,8H2;1H4.
What are the key properties of 5-bromo-2-nitroaniline;methane?
5-bromo-2-nitroaniline;methane has a molecular weight of 233.06 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-nitroaniline;methane is sourced from PubChem (CID 139511978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).