C15H18N4O — CID 175320488
N,N-dimethyl-3-phenyldiazenylaniline;formamide (PubChem CID 175320488) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyldiazenylaniline;formamide.
| Compound Name | N,N-dimethyl-3-phenyldiazenylaniline;formamide |
|---|---|
| PubChem CID | 175320488 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N,N-dimethyl-3-phenyldiazenylaniline;formamide |
| SMILES | CN(C)c1cccc(/N=N/c2ccccc2)c1.NC=O |
| InChI | InChI=1S/C14H15N3.CH3NO/c1-17(2)14-10-6-9-13(11-14)16-15-12-7-4-3-5-8-12;2-1-3/h3-11H,1-2H3;1H,(H2,2,3)/b16-15+; |
| InChIKey | LNAMYJIHDXEXSM-GEEYTBSJSA-N |
| XLogP | 3.27 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|