C9H11N3 — CID 174368516
3-(iminomethylideneamino)-N,N-dimethylaniline (PubChem CID 174368516) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-(iminomethylideneamino)-N,N-dimethylaniline.
| Compound Name | 3-(iminomethylideneamino)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 174368516 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-(iminomethylideneamino)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(N=C=N)c1 |
| InChI | InChI=1S/C9H11N3/c1-12(2)9-5-3-4-8(6-9)11-7-10/h3-6,10H,1-2H3 |
| InChIKey | DWQDPDRPTMEYFE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|