C18H20N2 — CID 57303024
4-ethenyl-N,N-dimethyl-3-(2-phenylethylideneamino)aniline (PubChem CID 57303024) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-ethenyl-N,N-dimethyl-3-(2-phenylethylideneamino)aniline.
| Compound Name | 4-ethenyl-N,N-dimethyl-3-(2-phenylethylideneamino)aniline |
|---|---|
| PubChem CID | 57303024 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-ethenyl-N,N-dimethyl-3-(2-phenylethylideneamino)aniline |
| SMILES | C=Cc1ccc(N(C)C)cc1/N=C/Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-4-16-10-11-17(20(2)3)14-18(16)19-13-12-15-8-6-5-7-9-15/h4-11,13-14H,1,12H2,2-3H3/b19-13+ |
| InChIKey | PQZZUURXTHJXSY-CPNJWEJPSA-N |
| XLogP | 4.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|