C16H16FN — CID 21116999
3-fluoro-N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline (PubChem CID 21116999) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline.
| Compound Name | 3-fluoro-N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline |
|---|---|
| PubChem CID | 21116999 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-fluoro-N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C16H16FN/c1-18(2)15-11-10-14(16(17)12-15)9-8-13-6-4-3-5-7-13/h3-12H,1-2H3/b9-8+ |
| InChIKey | HKGVCHLCVJODES-CMDGGOBGSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|